C25H24FN3O2 — CID 163572506
1-[1-[4-(4-fluorophenyl)phenyl]-2-oxopiperidin-3-yl]-3-(4-methylphenyl)urea (PubChem CID 163572506) has the molecular formula C25H24FN3O2 and a molecular weight of 417.48 g/mol. Its IUPAC name is 1-[1-[4-(4-fluorophenyl)phenyl]-2-oxopiperidin-3-yl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[1-[4-(4-fluorophenyl)phenyl]-2-oxopiperidin-3-yl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 163572506 |
| Molecular Formula | C25H24FN3O2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-[1-[4-(4-fluorophenyl)phenyl]-2-oxopiperidin-3-yl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NC2CCCN(c3ccc(-c4ccc(F)cc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H24FN3O2/c1-17-4-12-21(13-5-17)27-25(31)28-23-3-2-16-29(24(23)30)22-14-8-19(9-15-22)18-6-10-20(26)11-7-18/h4-15,23H,2-3,16H2,1H3,(H2,27,28,31) |
| InChIKey | GAPUUILIROJEQW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |