C24H23N4O2W- — CID 155745678
[2-[4-[2-oxo-3-(phenylcarbamoylamino)piperidin-1-yl]phenyl]phenyl]azanide;tungsten (PubChem CID 155745678) has the molecular formula C24H23N4O2W- and a molecular weight of 583.31 g/mol. Its IUPAC name is [2-[4-[2-oxo-3-(phenylcarbamoylamino)piperidin-1-yl]phenyl]phenyl]azanide;tungsten.
| Compound Name | [2-[4-[2-oxo-3-(phenylcarbamoylamino)piperidin-1-yl]phenyl]phenyl]azanide;tungsten |
|---|---|
| PubChem CID | 155745678 |
| Molecular Formula | C24H23N4O2W- |
| Molecular Weight | 583.31 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | [2-[4-[2-oxo-3-(phenylcarbamoylamino)piperidin-1-yl]phenyl]phenyl]azanide;tungsten |
| SMILES | [NH-]c1ccccc1-c1ccc(N2CCCC(NC(=O)Nc3ccccc3)C2=O)cc1.[W] |
| InChI | InChI=1S/C24H23N4O2.W/c25-21-10-5-4-9-20(21)17-12-14-19(15-13-17)28-16-6-11-22(23(28)29)27-24(30)26-18-7-2-1-3-8-18;/h1-5,7-10,12-15,22,25H,6,11,16H2,(H2,26,27,30);/q-1; |
| InChIKey | WCWSTHZVXFDTNA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.31 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |