C24H20F4N4O2 — CID 142493644
1-[(3R)-1-[4-(6-fluoro-2-pyridinyl)phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 142493644) has the molecular formula C24H20F4N4O2 and a molecular weight of 472.44 g/mol. Its IUPAC name is 1-[(3R)-1-[4-(6-fluoro-2-pyridinyl)phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3R)-1-[4-(6-fluoro-2-pyridinyl)phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 142493644 |
| Molecular Formula | C24H20F4N4O2 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 1-[(3R)-1-[4-(6-fluoro-2-pyridinyl)phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N[C@@H]1CCCN(c2ccc(-c3cccc(F)n3)cc2)C1=O |
| InChI | InChI=1S/C24H20F4N4O2/c25-21-5-1-3-19(30-21)15-6-12-18(13-7-15)32-14-2-4-20(22(32)33)31-23(34)29-17-10-8-16(9-11-17)24(26,27)28/h1,3,5-13,20H,2,4,14H2,(H2,29,31,34)/t20-/m1/s1 |
| InChIKey | UBRUOKZCCKGZGS-HXUWFJFHSA-N |
| XLogP | 5.22 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|