C26H23F3N4O3 — CID 175205116
2-[2-oxo-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]piperidin-1-yl]-3-phenylbenzamide (PubChem CID 175205116) has the molecular formula C26H23F3N4O3 and a molecular weight of 496.49 g/mol. Its IUPAC name is 2-[2-oxo-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]piperidin-1-yl]-3-phenylbenzamide.
| Compound Name | 2-[2-oxo-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]piperidin-1-yl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 175205116 |
| Molecular Formula | C26H23F3N4O3 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-[2-oxo-3-[[4-(trifluoromethyl)phenyl]carbamoylamino]piperidin-1-yl]-3-phenylbenzamide |
| SMILES | NC(=O)c1cccc(-c2ccccc2)c1N1CCCC(NC(=O)Nc2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C26H23F3N4O3/c27-26(28,29)17-11-13-18(14-12-17)31-25(36)32-21-10-5-15-33(24(21)35)22-19(16-6-2-1-3-7-16)8-4-9-20(22)23(30)34/h1-4,6-9,11-14,21H,5,10,15H2,(H2,30,34)(H2,31,32,36) |
| InChIKey | XWYNJLFQQKQCAJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |