C28H29F3N4O3 — CID 175010398
1-[1-(2,3-dimethyl-4-phenylphenyl)-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea;formamide (PubChem CID 175010398) has the molecular formula C28H29F3N4O3 and a molecular weight of 526.56 g/mol. Its IUPAC name is 1-[1-(2,3-dimethyl-4-phenylphenyl)-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea;formamide.
| Compound Name | 1-[1-(2,3-dimethyl-4-phenylphenyl)-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea;formamide |
|---|---|
| PubChem CID | 175010398 |
| Molecular Formula | C28H29F3N4O3 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 1-[1-(2,3-dimethyl-4-phenylphenyl)-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea;formamide |
| SMILES | Cc1c(-c2ccccc2)ccc(N2CCCC(NC(=O)Nc3ccc(C(F)(F)F)cc3)C2=O)c1C.NC=O |
| InChI | InChI=1S/C27H26F3N3O2.CH3NO/c1-17-18(2)24(15-14-22(17)19-7-4-3-5-8-19)33-16-6-9-23(25(33)34)32-26(35)31-21-12-10-20(11-13-21)27(28,29)30;2-1-3/h3-5,7-8,10-15,23H,6,9,16H2,1-2H3,(H2,31,32,35);1H,(H2,2,3) |
| InChIKey | GRNMVIWJYNETJB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|