C25H24F3N5O2S — CID 166854887
1-[(3R)-1-[4-[2-(methylsulfanylamino)-3-pyridinyl]phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 166854887) has the molecular formula C25H24F3N5O2S and a molecular weight of 515.56 g/mol. Its IUPAC name is 1-[(3R)-1-[4-[2-(methylsulfanylamino)-3-pyridinyl]phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3R)-1-[4-[2-(methylsulfanylamino)-3-pyridinyl]phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 166854887 |
| Molecular Formula | C25H24F3N5O2S |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 1-[(3R)-1-[4-[2-(methylsulfanylamino)-3-pyridinyl]phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CSNc1ncccc1-c1ccc(N2CCC[C@@H](NC(=O)Nc3ccc(C(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H24F3N5O2S/c1-36-32-22-20(4-2-14-29-22)16-6-12-19(13-7-16)33-15-3-5-21(23(33)34)31-24(35)30-18-10-8-17(9-11-18)25(26,27)28/h2,4,6-14,21H,3,5,15H2,1H3,(H,29,32)(H2,30,31,35)/t21-/m1/s1 |
| InChIKey | DFLFVMIZLYYNPC-OAQYLSRUSA-N |
| XLogP | 5.77 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|