C20H24N4O2 — CID 167807431
1-[2-(aminomethyl)phenyl]-3-[1-(4-methylphenyl)-2-oxopiperidin-3-yl]urea (PubChem CID 167807431) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[2-(aminomethyl)phenyl]-3-[1-(4-methylphenyl)-2-oxopiperidin-3-yl]urea.
| Compound Name | 1-[2-(aminomethyl)phenyl]-3-[1-(4-methylphenyl)-2-oxopiperidin-3-yl]urea |
|---|---|
| PubChem CID | 167807431 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[2-(aminomethyl)phenyl]-3-[1-(4-methylphenyl)-2-oxopiperidin-3-yl]urea |
| SMILES | Cc1ccc(N2CCCC(NC(=O)Nc3ccccc3CN)C2=O)cc1 |
| InChI | InChI=1S/C20H24N4O2/c1-14-8-10-16(11-9-14)24-12-4-7-18(19(24)25)23-20(26)22-17-6-3-2-5-15(17)13-21/h2-3,5-6,8-11,18H,4,7,12-13,21H2,1H3,(H2,22,23,26) |
| InChIKey | PECVQZZNXDKSJV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |