C24H29ClN4O3 — CID 152909543
1-(4-chlorophenyl)-3-[(3R)-1-[4-(3-hydroxy-3-methylpiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]urea (PubChem CID 152909543) has the molecular formula C24H29ClN4O3 and a molecular weight of 456.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(3R)-1-[4-(3-hydroxy-3-methylpiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(3R)-1-[4-(3-hydroxy-3-methylpiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]urea |
|---|---|
| PubChem CID | 152909543 |
| Molecular Formula | C24H29ClN4O3 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(3R)-1-[4-(3-hydroxy-3-methylpiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]urea |
| SMILES | CC1(O)CCCN(c2ccc(N3CCC[C@@H](NC(=O)Nc4ccc(Cl)cc4)C3=O)cc2)C1 |
| InChI | InChI=1S/C24H29ClN4O3/c1-24(32)13-3-14-28(16-24)19-9-11-20(12-10-19)29-15-2-4-21(22(29)30)27-23(31)26-18-7-5-17(25)6-8-18/h5-12,21,32H,2-4,13-16H2,1H3,(H2,26,27,31)/t21-,24?/m1/s1 |
| InChIKey | UGXPTKNCXWDZPN-CILPGNKCSA-N |
| XLogP | 4.01 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|