C17H26F2N4O2 — CID 142493531
[(3R)-1-[4-(3,3-difluoropiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]urea;molecular hydrogen (PubChem CID 142493531) has the molecular formula C17H26F2N4O2 and a molecular weight of 356.42 g/mol. Its IUPAC name is [(3R)-1-[4-(3,3-difluoropiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]urea;molecular hydrogen.
| Compound Name | [(3R)-1-[4-(3,3-difluoropiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]urea;molecular hydrogen |
|---|---|
| PubChem CID | 142493531 |
| Molecular Formula | C17H26F2N4O2 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(3R)-1-[4-(3,3-difluoropiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]urea;molecular hydrogen |
| SMILES | NC(=O)N[C@@H]1CCCN(c2ccc(N3CCCC(F)(F)C3)cc2)C1=O.[H][H].[H][H] |
| InChI | InChI=1S/C17H22F2N4O2.2H2/c18-17(19)8-2-9-22(11-17)12-4-6-13(7-5-12)23-10-1-3-14(15(23)24)21-16(20)25;;/h4-7,14H,1-3,8-11H2,(H3,20,21,25);2*1H/t14-;;/m1../s1 |
| InChIKey | FXNVAXVWPNQXSO-FMOMHUKBSA-N |
| XLogP | 2.58 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|