About [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea
[(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea (PubChem CID 142493505) has the molecular formula C16H19F3N4O2
and a molecular weight of 356.35 g/mol. Its IUPAC name is [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea.
Molecular Properties
| Compound Name | [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea |
| PubChem CID | 142493505 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea |
| SMILES | NC(=O)N[C@@H]1CCCN(c2ccc(N3CC[C@@H](F)C3)c(F)c2F)C1=O |
| InChI | InChI=1S/C16H19F3N4O2/c17-9-5-7-22(8-9)11-3-4-12(14(19)13(11)18)23-6-1-2-10(15(23)24)21-16(20)25/h3-4,9-10H,1-2,5-8H2,(H3,20,21,25)/t9-,10-/m1/s1 |
| InChIKey | LHPUDMLYUZYUIQ-NXEZZACHSA-N |
| XLogP | 1.68 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea?
The IUPAC name of [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea (CID 142493505) is [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea.
What is the SMILES notation for [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea?
The canonical SMILES for [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea is NC(=O)N[C@@H]1CCCN(c2ccc(N3CC[C@@H](F)C3)c(F)c2F)C1=O.
What is the InChIKey of [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea?
The InChIKey is LHPUDMLYUZYUIQ-NXEZZACHSA-N. The full InChI is InChI=1S/C16H19F3N4O2/c17-9-5-7-22(8-9)11-3-4-12(14(19)13(11)18)23-6-1-2-10(15(23)24)21-16(20)25/h3-4,9-10H,1-2,5-8H2,(H3,20,21,25)/t9-,10-/m1/s1.
What are the key properties of [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea?
[(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea has a molecular weight of 356.35 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-[2,3-difluoro-4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-2-oxopiperidin-3-yl]urea is sourced from PubChem (CID 142493505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).