C15H21N5O — CID 124621931
1-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-phenylpiperidin-4-ol (PubChem CID 124621931) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 1-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-phenylpiperidin-4-ol.
| Compound Name | 1-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-phenylpiperidin-4-ol |
|---|---|
| PubChem CID | 124621931 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-phenylpiperidin-4-ol |
| SMILES | C[C@@H](c1nnnn1C)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H21N5O/c1-12(14-16-17-18-19(14)2)20-10-8-15(21,9-11-20)13-6-4-3-5-7-13/h3-7,12,21H,8-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | RKGRIGAREFZCON-LBPRGKRZSA-N |
| XLogP | 1.25 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |