C29H43NO3Si — CID 10457934
(2S)-2-(4-hydroxy-4-phenylpiperidin-1-yl)-1-[4-tri(propan-2-yl)silyloxyphenyl]propan-1-one (PubChem CID 10457934) has the molecular formula C29H43NO3Si and a molecular weight of 481.75 g/mol. Its IUPAC name is (2S)-2-(4-hydroxy-4-phenylpiperidin-1-yl)-1-[4-tri(propan-2-yl)silyloxyphenyl]propan-1-one.
| Compound Name | (2S)-2-(4-hydroxy-4-phenylpiperidin-1-yl)-1-[4-tri(propan-2-yl)silyloxyphenyl]propan-1-one |
|---|---|
| PubChem CID | 10457934 |
| Molecular Formula | C29H43NO3Si |
| Molecular Weight | 481.75 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | (2S)-2-(4-hydroxy-4-phenylpiperidin-1-yl)-1-[4-tri(propan-2-yl)silyloxyphenyl]propan-1-one |
| SMILES | CC(C)[Si](Oc1ccc(C(=O)[C@H](C)N2CCC(O)(c3ccccc3)CC2)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H43NO3Si/c1-21(2)34(22(3)4,23(5)6)33-27-15-13-25(14-16-27)28(31)24(7)30-19-17-29(32,18-20-30)26-11-9-8-10-12-26/h8-16,21-24,32H,17-20H2,1-7H3/t24-/m0/s1 |
| InChIKey | UNRHYKUJRVFZKJ-DEOSSOPVSA-N |
| XLogP | 6.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|