C31H47NO3Si — CID 10413970
2-(4-benzyl-4-hydroxypiperidin-1-yl)-1-[4-tri(propan-2-yl)silyloxyphenyl]butan-1-one (PubChem CID 10413970) has the molecular formula C31H47NO3Si and a molecular weight of 509.81 g/mol. Its IUPAC name is 2-(4-benzyl-4-hydroxypiperidin-1-yl)-1-[4-tri(propan-2-yl)silyloxyphenyl]butan-1-one.
| Compound Name | 2-(4-benzyl-4-hydroxypiperidin-1-yl)-1-[4-tri(propan-2-yl)silyloxyphenyl]butan-1-one |
|---|---|
| PubChem CID | 10413970 |
| Molecular Formula | C31H47NO3Si |
| Molecular Weight | 509.81 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | 2-(4-benzyl-4-hydroxypiperidin-1-yl)-1-[4-tri(propan-2-yl)silyloxyphenyl]butan-1-one |
| SMILES | CCC(C(=O)c1ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc1)N1CCC(O)(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H47NO3Si/c1-8-29(32-20-18-31(34,19-21-32)22-26-12-10-9-11-13-26)30(33)27-14-16-28(17-15-27)35-36(23(2)3,24(4)5)25(6)7/h9-17,23-25,29,34H,8,18-22H2,1-7H3 |
| InChIKey | UYHWMLHEPJEBMP-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.81 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|