C35H46O5Si — CID 101121470
3-ethyl-1,2-bis(4-methoxyphenyl)-4-[4-tri(propan-2-yl)silyloxyphenyl]butane-1,4-dione (PubChem CID 101121470) has the molecular formula C35H46O5Si and a molecular weight of 574.83 g/mol. Its IUPAC name is 3-ethyl-1,2-bis(4-methoxyphenyl)-4-[4-tri(propan-2-yl)silyloxyphenyl]butane-1,4-dione.
| Compound Name | 3-ethyl-1,2-bis(4-methoxyphenyl)-4-[4-tri(propan-2-yl)silyloxyphenyl]butane-1,4-dione |
|---|---|
| PubChem CID | 101121470 |
| Molecular Formula | C35H46O5Si |
| Molecular Weight | 574.83 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | 3-ethyl-1,2-bis(4-methoxyphenyl)-4-[4-tri(propan-2-yl)silyloxyphenyl]butane-1,4-dione |
| SMILES | CCC(C(=O)c1ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc1)C(C(=O)c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C35H46O5Si/c1-10-32(34(36)27-15-21-31(22-16-27)40-41(23(2)3,24(4)5)25(6)7)33(26-11-17-29(38-8)18-12-26)35(37)28-13-19-30(39-9)20-14-28/h11-25,32-33H,10H2,1-9H3 |
| InChIKey | RGMXLAROCVGYDA-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.83 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|