C11H23N5 — CID 103085250
N-[1-(1-tert-butyltetrazol-5-yl)ethyl]-2-methylpropan-1-amine (PubChem CID 103085250) has the molecular formula C11H23N5 and a molecular weight of 225.34 g/mol. Its IUPAC name is N-[1-(1-tert-butyltetrazol-5-yl)ethyl]-2-methylpropan-1-amine.
| Compound Name | N-[1-(1-tert-butyltetrazol-5-yl)ethyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 103085250 |
| Molecular Formula | C11H23N5 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | N-[1-(1-tert-butyltetrazol-5-yl)ethyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNC(C)c1nnnn1C(C)(C)C |
| InChI | InChI=1S/C11H23N5/c1-8(2)7-12-9(3)10-13-14-15-16(10)11(4,5)6/h8-9,12H,7H2,1-6H3 |
| InChIKey | RFRFVNHRWIGTAL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |