C13H25N5O — CID 1438536
4-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]morpholine (PubChem CID 1438536) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]morpholine.
| Compound Name | 4-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]morpholine |
|---|---|
| PubChem CID | 1438536 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 4-[(1S)-1-(1-tert-butyltetrazol-5-yl)-2-methylpropyl]morpholine |
| SMILES | CC(C)[C@@H](c1nnnn1C(C)(C)C)N1CCOCC1 |
| InChI | InChI=1S/C13H25N5O/c1-10(2)11(17-6-8-19-9-7-17)12-14-15-16-18(12)13(3,4)5/h10-11H,6-9H2,1-5H3/t11-/m0/s1 |
| InChIKey | HWWNQRKZVZGRQZ-NSHDSACASA-N |
| XLogP | 1.46 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |