C21H31FN6 — CID 1444178
1-[(R)-(1-tert-butyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-cyclopentylpiperazine (PubChem CID 1444178) has the molecular formula C21H31FN6 and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[(R)-(1-tert-butyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-cyclopentylpiperazine.
| Compound Name | 1-[(R)-(1-tert-butyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-cyclopentylpiperazine |
|---|---|
| PubChem CID | 1444178 |
| Molecular Formula | C21H31FN6 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 1-[(R)-(1-tert-butyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-cyclopentylpiperazine |
| SMILES | CC(C)(C)n1nnnc1[C@@H](c1ccccc1F)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C21H31FN6/c1-21(2,3)28-20(23-24-25-28)19(17-10-6-7-11-18(17)22)27-14-12-26(13-15-27)16-8-4-5-9-16/h6-7,10-11,16,19H,4-5,8-9,12-15H2,1-3H3/t19-/m1/s1 |
| InChIKey | ZICBVKSKPAVMFM-LJQANCHMSA-N |
| XLogP | 3.22 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |