C20H27FN6 — CID 1443638
1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-prop-2-enylpiperazine (PubChem CID 1443638) has the molecular formula C20H27FN6 and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 1443638 |
| Molecular Formula | C20H27FN6 |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@@H](c2ccccc2F)c2nnnn2C2CCCC2)CC1 |
| InChI | InChI=1S/C20H27FN6/c1-2-11-25-12-14-26(15-13-25)19(17-9-5-6-10-18(17)21)20-22-23-24-27(20)16-7-3-4-8-16/h2,5-6,9-10,16,19H,1,3-4,7-8,11-15H2/t19-/m0/s1 |
| InChIKey | AVDCIPOIHIYWPD-IBGZPJMESA-N |
| XLogP | 2.82 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|