C30H35N7 — CID 51360439
4-[(1-cyclohexyltetrazol-5-yl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]quinoline (PubChem CID 51360439) has the molecular formula C30H35N7 and a molecular weight of 493.66 g/mol. Its IUPAC name is 4-[(1-cyclohexyltetrazol-5-yl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]quinoline.
| Compound Name | 4-[(1-cyclohexyltetrazol-5-yl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 51360439 |
| Molecular Formula | C30H35N7 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | 4-[(1-cyclohexyltetrazol-5-yl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]quinoline |
| SMILES | C(=C/c1ccccc1)\CN1CCN(C(c2ccnc3ccccc23)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C30H35N7/c1-3-10-24(11-4-1)12-9-19-35-20-22-36(23-21-35)29(27-17-18-31-28-16-8-7-15-26(27)28)30-32-33-34-37(30)25-13-5-2-6-14-25/h1,3-4,7-12,15-18,25,29H,2,5-6,13-14,19-23H2/b12-9+ |
| InChIKey | DFLAHFLLCUSWBA-FMIVXFBMSA-N |
| XLogP | 5.15 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |