C25H34N6O — CID 51625966
1-benzyl-4-[(1S)-1-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]pentyl]piperazine (PubChem CID 51625966) has the molecular formula C25H34N6O and a molecular weight of 434.59 g/mol. Its IUPAC name is 1-benzyl-4-[(1S)-1-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]pentyl]piperazine.
| Compound Name | 1-benzyl-4-[(1S)-1-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]pentyl]piperazine |
|---|---|
| PubChem CID | 51625966 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 1-benzyl-4-[(1S)-1-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]pentyl]piperazine |
| SMILES | CCCC[C@@H](c1nnnn1Cc1ccc(OC)cc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H34N6O/c1-3-4-10-24(30-17-15-29(16-18-30)19-21-8-6-5-7-9-21)25-26-27-28-31(25)20-22-11-13-23(32-2)14-12-22/h5-9,11-14,24H,3-4,10,15-20H2,1-2H3/t24-/m0/s1 |
| InChIKey | SBHWSRKBRYGJTH-DEOSSOPVSA-N |
| XLogP | 3.78 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |