C24H33N7O2 — CID 167645921
tert-butyl 4-[(1-benzyltetrazol-5-yl)-pyridin-3-ylmethyl]piperazine-1-carboxylate;methane (PubChem CID 167645921) has the molecular formula C24H33N7O2 and a molecular weight of 451.58 g/mol. Its IUPAC name is tert-butyl 4-[(1-benzyltetrazol-5-yl)-pyridin-3-ylmethyl]piperazine-1-carboxylate;methane.
| Compound Name | tert-butyl 4-[(1-benzyltetrazol-5-yl)-pyridin-3-ylmethyl]piperazine-1-carboxylate;methane |
|---|---|
| PubChem CID | 167645921 |
| Molecular Formula | C24H33N7O2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | tert-butyl 4-[(1-benzyltetrazol-5-yl)-pyridin-3-ylmethyl]piperazine-1-carboxylate;methane |
| SMILES | C.CC(C)(C)OC(=O)N1CCN(C(c2cccnc2)c2nnnn2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29N7O2.CH4/c1-23(2,3)32-22(31)29-14-12-28(13-15-29)20(19-10-7-11-24-16-19)21-25-26-27-30(21)17-18-8-5-4-6-9-18;/h4-11,16,20H,12-15,17H2,1-3H3;1H4 |
| InChIKey | PWFMCFDPAFKWLM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |