C36H46Cl2N8O2 — CID 157457132
tert-butyl 4-(dipyridin-3-ylmethyl)piperazine-1-carboxylate;dichloromethane;1-(dipyridin-3-ylmethyl)piperazine (PubChem CID 157457132) has the molecular formula C36H46Cl2N8O2 and a molecular weight of 693.72 g/mol. Its IUPAC name is tert-butyl 4-(dipyridin-3-ylmethyl)piperazine-1-carboxylate;dichloromethane;1-(dipyridin-3-ylmethyl)piperazine.
| Compound Name | tert-butyl 4-(dipyridin-3-ylmethyl)piperazine-1-carboxylate;dichloromethane;1-(dipyridin-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 157457132 |
| Molecular Formula | C36H46Cl2N8O2 |
| Molecular Weight | 693.72 g/mol |
| Exact Mass | 692.31 |
| IUPAC Name | tert-butyl 4-(dipyridin-3-ylmethyl)piperazine-1-carboxylate;dichloromethane;1-(dipyridin-3-ylmethyl)piperazine |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(c2cccnc2)c2cccnc2)CC1.ClCCl.c1cncc(C(c2cccnc2)N2CCNCC2)c1 |
| InChI | InChI=1S/C20H26N4O2.C15H18N4.CH2Cl2/c1-20(2,3)26-19(25)24-12-10-23(11-13-24)18(16-6-4-8-21-14-16)17-7-5-9-22-15-17;1-3-13(11-17-5-1)15(14-4-2-6-18-12-14)19-9-7-16-8-10-19;2-1-3/h4-9,14-15,18H,10-13H2,1-3H3;1-6,11-12,15-16H,7-10H2;1H2 |
| InChIKey | BTMLVDYJYTUNCT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.72 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|