C8H13ClN4O — CID 103084369
5-(1-chloroethyl)-1-(oxolan-2-ylmethyl)tetrazole (PubChem CID 103084369) has the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. Its IUPAC name is 5-(1-chloroethyl)-1-(oxolan-2-ylmethyl)tetrazole.
| Compound Name | 5-(1-chloroethyl)-1-(oxolan-2-ylmethyl)tetrazole |
|---|---|
| PubChem CID | 103084369 |
| Molecular Formula | C8H13ClN4O |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 5-(1-chloroethyl)-1-(oxolan-2-ylmethyl)tetrazole |
| SMILES | CC(Cl)c1nnnn1CC1CCCO1 |
| InChI | InChI=1S/C8H13ClN4O/c1-6(9)8-10-11-12-13(8)5-7-3-2-4-14-7/h6-7H,2-5H2,1H3 |
| InChIKey | AUBMQEBIKJSWSQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|