C17H32N6O — CID 3209506
1-ethyl-4-[3-methyl-1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine (PubChem CID 3209506) has the molecular formula C17H32N6O and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-ethyl-4-[3-methyl-1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine.
| Compound Name | 1-ethyl-4-[3-methyl-1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine |
|---|---|
| PubChem CID | 3209506 |
| Molecular Formula | C17H32N6O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 1-ethyl-4-[3-methyl-1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine |
| SMILES | CCN1CCN(C(CC(C)C)c2nnnn2CC2CCCO2)CC1 |
| InChI | InChI=1S/C17H32N6O/c1-4-21-7-9-22(10-8-21)16(12-14(2)3)17-18-19-20-23(17)13-15-6-5-11-24-15/h14-16H,4-13H2,1-3H3 |
| InChIKey | TUEIZGZBLUQOPI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |