C26H31N7O — CID 51360364
3-[1-[(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 51360364) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is 3-[1-[(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 51360364 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 3-[1-[(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1CCN(C(c2ccccc2)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C26H31N7O/c34-26-27-22-13-7-8-14-23(22)32(26)20-15-17-31(18-16-20)24(19-9-3-1-4-10-19)25-28-29-30-33(25)21-11-5-2-6-12-21/h1,3-4,7-10,13-14,20-21,24H,2,5-6,11-12,15-18H2,(H,27,34) |
| InChIKey | SLNVDAOZJYFFDM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |