C20H31N5 — CID 3193570
3-methyl-1-[[1-(2-methylbutan-2-yl)tetrazol-5-yl]-(4-methylphenyl)methyl]piperidine (PubChem CID 3193570) has the molecular formula C20H31N5 and a molecular weight of 341.50 g/mol. Its IUPAC name is 3-methyl-1-[[1-(2-methylbutan-2-yl)tetrazol-5-yl]-(4-methylphenyl)methyl]piperidine.
| Compound Name | 3-methyl-1-[[1-(2-methylbutan-2-yl)tetrazol-5-yl]-(4-methylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 3193570 |
| Molecular Formula | C20H31N5 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 3-methyl-1-[[1-(2-methylbutan-2-yl)tetrazol-5-yl]-(4-methylphenyl)methyl]piperidine |
| SMILES | CCC(C)(C)n1nnnc1C(c1ccc(C)cc1)N1CCCC(C)C1 |
| InChI | InChI=1S/C20H31N5/c1-6-20(4,5)25-19(21-22-23-25)18(17-11-9-15(2)10-12-17)24-13-7-8-16(3)14-24/h9-12,16,18H,6-8,13-14H2,1-5H3 |
| InChIKey | FKRRZKIHIZFAAX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |