C23H30N6 — CID 1433666
4-[(S)-(1-tert-butyltetrazol-5-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N,N-dimethylaniline (PubChem CID 1433666) has the molecular formula C23H30N6 and a molecular weight of 390.54 g/mol. Its IUPAC name is 4-[(S)-(1-tert-butyltetrazol-5-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(S)-(1-tert-butyltetrazol-5-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 1433666 |
| Molecular Formula | C23H30N6 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 4-[(S)-(1-tert-butyltetrazol-5-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@@H](c2nnnn2C(C)(C)C)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C23H30N6/c1-23(2,3)29-22(24-25-26-29)21(18-10-12-20(13-11-18)27(4)5)28-15-14-17-8-6-7-9-19(17)16-28/h6-13,21H,14-16H2,1-5H3/t21-/m0/s1 |
| InChIKey | AAFZDYDDZPHGMB-NRFANRHFSA-N |
| XLogP | 3.64 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|