C24H35ClN2O3 — CID 142237381
1-[2-[4-[(4-methylphenyl)-phenylmethyl]piperazin-1-yl]ethoxy]butane-2,3-diol;hydrochloride (PubChem CID 142237381) has the molecular formula C24H35ClN2O3 and a molecular weight of 435.01 g/mol. Its IUPAC name is 1-[2-[4-[(4-methylphenyl)-phenylmethyl]piperazin-1-yl]ethoxy]butane-2,3-diol;hydrochloride.
| Compound Name | 1-[2-[4-[(4-methylphenyl)-phenylmethyl]piperazin-1-yl]ethoxy]butane-2,3-diol;hydrochloride |
|---|---|
| PubChem CID | 142237381 |
| Molecular Formula | C24H35ClN2O3 |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 1-[2-[4-[(4-methylphenyl)-phenylmethyl]piperazin-1-yl]ethoxy]butane-2,3-diol;hydrochloride |
| SMILES | Cc1ccc(C(c2ccccc2)N2CCN(CCOCC(O)C(C)O)CC2)cc1.Cl |
| InChI | InChI=1S/C24H34N2O3.ClH/c1-19-8-10-22(11-9-19)24(21-6-4-3-5-7-21)26-14-12-25(13-15-26)16-17-29-18-23(28)20(2)27;/h3-11,20,23-24,27-28H,12-18H2,1-2H3;1H |
| InChIKey | XFTBNWYPRBYUHY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|