C36H44ClN3O6 — CID 70155297
5-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-6-methoxy-2,4-dioxoquinazolin-3-yl]pentanoic acid;hydrochloride (PubChem CID 70155297) has the molecular formula C36H44ClN3O6 and a molecular weight of 650.22 g/mol. Its IUPAC name is 5-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-6-methoxy-2,4-dioxoquinazolin-3-yl]pentanoic acid;hydrochloride.
| Compound Name | 5-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-6-methoxy-2,4-dioxoquinazolin-3-yl]pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70155297 |
| Molecular Formula | C36H44ClN3O6 |
| Molecular Weight | 650.22 g/mol |
| Exact Mass | 649.29 |
| IUPAC Name | 5-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-6-methoxy-2,4-dioxoquinazolin-3-yl]pentanoic acid;hydrochloride |
| SMILES | COc1ccc2c(c1)c(=O)n(CCCCC(=O)O)c(=O)n2CCCCN1CCC(OC(c2ccccc2)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C36H43N3O6.ClH/c1-44-30-17-18-32-31(26-30)35(42)39(23-9-8-16-33(40)41)36(43)38(32)22-11-10-21-37-24-19-29(20-25-37)45-34(27-12-4-2-5-13-27)28-14-6-3-7-15-28;/h2-7,12-15,17-18,26,29,34H,8-11,16,19-25H2,1H3,(H,40,41);1H |
| InChIKey | COJRBDCYYCKJOB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.22 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|