C39H41N3O5 — CID 22449727
ethyl 2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-3-yl]benzoate (PubChem CID 22449727) has the molecular formula C39H41N3O5 and a molecular weight of 631.77 g/mol. Its IUPAC name is ethyl 2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-3-yl]benzoate.
| Compound Name | ethyl 2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-3-yl]benzoate |
|---|---|
| PubChem CID | 22449727 |
| Molecular Formula | C39H41N3O5 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | ethyl 2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1-n1c(=O)c2ccccc2n(CCCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)c1=O |
| InChI | InChI=1S/C39H41N3O5/c1-2-46-38(44)33-20-10-12-22-35(33)42-37(43)32-19-9-11-21-34(32)41(39(42)45)26-14-13-25-40-27-23-31(24-28-40)47-36(29-15-5-3-6-16-29)30-17-7-4-8-18-30/h3-12,15-22,31,36H,2,13-14,23-28H2,1H3 |
| InChIKey | UXPIKPZHDOUEOQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|