C37H46ClN3O6 — CID 22449805
ethyl 2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-8-methoxy-2,4-dioxoquinazolin-3-yl]-2-methylpropanoate;hydrochloride (PubChem CID 22449805) has the molecular formula C37H46ClN3O6 and a molecular weight of 664.24 g/mol. Its IUPAC name is ethyl 2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-8-methoxy-2,4-dioxoquinazolin-3-yl]-2-methylpropanoate;hydrochloride.
| Compound Name | ethyl 2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-8-methoxy-2,4-dioxoquinazolin-3-yl]-2-methylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 22449805 |
| Molecular Formula | C37H46ClN3O6 |
| Molecular Weight | 664.24 g/mol |
| Exact Mass | 663.31 |
| IUPAC Name | ethyl 2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-8-methoxy-2,4-dioxoquinazolin-3-yl]-2-methylpropanoate;hydrochloride |
| SMILES | CCOC(=O)C(C)(C)n1c(=O)c2cccc(OC)c2n(CCCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)c1=O.Cl |
| InChI | InChI=1S/C37H45N3O6.ClH/c1-5-45-35(42)37(2,3)40-34(41)30-19-14-20-31(44-4)32(30)39(36(40)43)24-13-12-23-38-25-21-29(22-26-38)46-33(27-15-8-6-9-16-27)28-17-10-7-11-18-28;/h6-11,14-20,29,33H,5,12-13,21-26H2,1-4H3;1H |
| InChIKey | NJFPDWKUKHCAQO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 92.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.24 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|