C39H41N3O5 — CID 22449741
methyl 2-[[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-3-yl]methyl]benzoate (PubChem CID 22449741) has the molecular formula C39H41N3O5 and a molecular weight of 631.77 g/mol. Its IUPAC name is methyl 2-[[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-3-yl]methyl]benzoate.
| Compound Name | methyl 2-[[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 22449741 |
| Molecular Formula | C39H41N3O5 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | methyl 2-[[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1Cn1c(=O)c2ccccc2n(CCCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)c1=O |
| InChI | InChI=1S/C39H41N3O5/c1-46-38(44)33-19-9-8-18-31(33)28-42-37(43)34-20-10-11-21-35(34)41(39(42)45)25-13-12-24-40-26-22-32(23-27-40)47-36(29-14-4-2-5-15-29)30-16-6-3-7-17-30/h2-11,14-21,32,36H,12-13,22-28H2,1H3 |
| InChIKey | SXBCIPRHVPHBKV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|