C32H39NO3 — CID 68881168
2-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-4-propan-2-ylbenzoic acid (PubChem CID 68881168) has the molecular formula C32H39NO3 and a molecular weight of 485.67 g/mol. Its IUPAC name is 2-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-4-propan-2-ylbenzoic acid.
| Compound Name | 2-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-4-propan-2-ylbenzoic acid |
|---|---|
| PubChem CID | 68881168 |
| Molecular Formula | C32H39NO3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 2-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-4-propan-2-ylbenzoic acid |
| SMILES | CC(C)c1ccc(C(=O)O)c(CCCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C32H39NO3/c1-24(2)27-16-17-30(32(34)35)28(23-27)15-9-10-20-33-21-18-29(19-22-33)36-31(25-11-5-3-6-12-25)26-13-7-4-8-14-26/h3-8,11-14,16-17,23-24,29,31H,9-10,15,18-22H2,1-2H3,(H,34,35) |
| InChIKey | ZODLPLYFDCTARS-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|