C32H36ClN3O5 — CID 22449834
methyl 1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazoline-5-carboxylate;hydrochloride (PubChem CID 22449834) has the molecular formula C32H36ClN3O5 and a molecular weight of 578.11 g/mol. Its IUPAC name is methyl 1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazoline-5-carboxylate;hydrochloride.
| Compound Name | methyl 1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazoline-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 22449834 |
| Molecular Formula | C32H36ClN3O5 |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | methyl 1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazoline-5-carboxylate;hydrochloride |
| SMILES | COC(=O)c1cccc2c1c(=O)[nH]c(=O)n2CCCCN1CCC(OC(c2ccccc2)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C32H35N3O5.ClH/c1-39-31(37)26-15-10-16-27-28(26)30(36)33-32(38)35(27)20-9-8-19-34-21-17-25(18-22-34)40-29(23-11-4-2-5-12-23)24-13-6-3-7-14-24;/h2-7,10-16,25,29H,8-9,17-22H2,1H3,(H,33,36,38);1H |
| InChIKey | UNIXVBQDWNFRSI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|