C27H29N3O2 — CID 13105612
3-[2-(4-benzhydryloxypiperidin-1-yl)ethyl]-1H-benzimidazol-2-one (PubChem CID 13105612) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-[2-(4-benzhydryloxypiperidin-1-yl)ethyl]-1H-benzimidazol-2-one.
| Compound Name | 3-[2-(4-benzhydryloxypiperidin-1-yl)ethyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 13105612 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 3-[2-(4-benzhydryloxypiperidin-1-yl)ethyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1CCN1CCC(OC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H29N3O2/c31-27-28-24-13-7-8-14-25(24)30(27)20-19-29-17-15-23(16-18-29)32-26(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-14,23,26H,15-20H2,(H,28,31) |
| InChIKey | XSFBTTMUSWCNFP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |