C30H34N4O3 — CID 22449621
7-amino-1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]quinazoline-2,4-dione (PubChem CID 22449621) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 7-amino-1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]quinazoline-2,4-dione.
| Compound Name | 7-amino-1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 22449621 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 7-amino-1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]quinazoline-2,4-dione |
| SMILES | Nc1ccc2c(=O)[nH]c(=O)n(CCCCN3CCC(OC(c4ccccc4)c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C30H34N4O3/c31-24-13-14-26-27(21-24)34(30(36)32-29(26)35)18-8-7-17-33-19-15-25(16-20-33)37-28(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-6,9-14,21,25,28H,7-8,15-20,31H2,(H,32,35,36) |
| InChIKey | HLFOCJIMPTWUBR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|