C35H41N5O5 — CID 70153837
N'-[2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-6-yl]ethyl]propanediamide (PubChem CID 70153837) has the molecular formula C35H41N5O5 and a molecular weight of 611.74 g/mol. Its IUPAC name is N'-[2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-6-yl]ethyl]propanediamide.
| Compound Name | N'-[2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-6-yl]ethyl]propanediamide |
|---|---|
| PubChem CID | 70153837 |
| Molecular Formula | C35H41N5O5 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | N'-[2-[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-6-yl]ethyl]propanediamide |
| SMILES | NC(=O)CC(=O)NCCc1ccc2c(c1)c(=O)[nH]c(=O)n2CCCCN1CCC(OC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C35H41N5O5/c36-31(41)24-32(42)37-18-15-25-13-14-30-29(23-25)34(43)38-35(44)40(30)20-8-7-19-39-21-16-28(17-22-39)45-33(26-9-3-1-4-10-26)27-11-5-2-6-12-27/h1-6,9-14,23,28,33H,7-8,15-22,24H2,(H2,36,41)(H,37,42)(H,38,43,44) |
| InChIKey | KNDCEJZZQHRDIQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|