C33H36N4O6 — CID 22449885
3-[[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-7-yl]amino]-3-oxopropanoic acid (PubChem CID 22449885) has the molecular formula C33H36N4O6 and a molecular weight of 584.67 g/mol. Its IUPAC name is 3-[[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-7-yl]amino]-3-oxopropanoic acid.
| Compound Name | 3-[[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-7-yl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 22449885 |
| Molecular Formula | C33H36N4O6 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 3-[[1-[4-(4-benzhydryloxypiperidin-1-yl)butyl]-2,4-dioxoquinazolin-7-yl]amino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1ccc2c(=O)[nH]c(=O)n(CCCCN3CCC(OC(c4ccccc4)c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C33H36N4O6/c38-29(22-30(39)40)34-25-13-14-27-28(21-25)37(33(42)35-32(27)41)18-8-7-17-36-19-15-26(16-20-36)43-31(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-6,9-14,21,26,31H,7-8,15-20,22H2,(H,34,38)(H,39,40)(H,35,41,42) |
| InChIKey | HZUNUSSMPIMVTQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|