C35H39NO6 — CID 10370780
ethyl 7-[5-(4-benzhydryloxypiperidin-1-yl)pentoxy]-4-oxochromene-2-carboxylate (PubChem CID 10370780) has the molecular formula C35H39NO6 and a molecular weight of 569.70 g/mol. Its IUPAC name is ethyl 7-[5-(4-benzhydryloxypiperidin-1-yl)pentoxy]-4-oxochromene-2-carboxylate.
| Compound Name | ethyl 7-[5-(4-benzhydryloxypiperidin-1-yl)pentoxy]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 10370780 |
| Molecular Formula | C35H39NO6 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | ethyl 7-[5-(4-benzhydryloxypiperidin-1-yl)pentoxy]-4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2ccc(OCCCCCN3CCC(OC(c4ccccc4)c4ccccc4)CC3)cc2o1 |
| InChI | InChI=1S/C35H39NO6/c1-2-39-35(38)33-25-31(37)30-17-16-29(24-32(30)42-33)40-23-11-5-10-20-36-21-18-28(19-22-36)41-34(26-12-6-3-7-13-26)27-14-8-4-9-15-27/h3-4,6-9,12-17,24-25,28,34H,2,5,10-11,18-23H2,1H3 |
| InChIKey | FTXCAPZXTSMJTG-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|