C29H36Cl2N2O5 — CID 67924673
(3,4-dimethoxyphenyl) 2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]acetate;dihydrochloride (PubChem CID 67924673) has the molecular formula C29H36Cl2N2O5 and a molecular weight of 563.52 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl) 2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]acetate;dihydrochloride.
| Compound Name | (3,4-dimethoxyphenyl) 2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]acetate;dihydrochloride |
|---|---|
| PubChem CID | 67924673 |
| Molecular Formula | C29H36Cl2N2O5 |
| Molecular Weight | 563.52 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | (3,4-dimethoxyphenyl) 2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]acetate;dihydrochloride |
| SMILES | COc1ccc(OC(=O)COCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1OC.Cl.Cl |
| InChI | InChI=1S/C29H34N2O5.2ClH/c1-33-26-14-13-25(21-27(26)34-2)36-28(32)22-35-20-19-30-15-17-31(18-16-30)29(23-9-5-3-6-10-23)24-11-7-4-8-12-24;;/h3-14,21,29H,15-20,22H2,1-2H3;2*1H |
| InChIKey | OMIQPUUSNSQAAX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|