C31H32ClNO2 — CID 22990630
1-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enyl]-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidine;hydrochloride (PubChem CID 22990630) has the molecular formula C31H32ClNO2 and a molecular weight of 486.06 g/mol. Its IUPAC name is 1-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enyl]-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidine;hydrochloride.
| Compound Name | 1-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enyl]-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidine;hydrochloride |
|---|---|
| PubChem CID | 22990630 |
| Molecular Formula | C31H32ClNO2 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 1-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enyl]-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidine;hydrochloride |
| SMILES | COc1ccc(/C=C/CN2CCC(=C3c4ccccc4C=Cc4ccccc43)CC2)c(OC)c1.Cl |
| InChI | InChI=1S/C31H31NO2.ClH/c1-33-27-16-15-25(30(22-27)34-2)10-7-19-32-20-17-26(18-21-32)31-28-11-5-3-8-23(28)13-14-24-9-4-6-12-29(24)31;/h3-16,22H,17-21H2,1-2H3;1H/b10-7+; |
| InChIKey | MZQFHOJHNRDNKK-HCUGZAAXSA-N |
| XLogP | 7.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|