C32H34ClNO3 — CID 70024576
4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enyl]piperidine;hydrochloride (PubChem CID 70024576) has the molecular formula C32H34ClNO3 and a molecular weight of 516.08 g/mol. Its IUPAC name is 4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enyl]piperidine;hydrochloride.
| Compound Name | 4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 70024576 |
| Molecular Formula | C32H34ClNO3 |
| Molecular Weight | 516.08 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enyl]piperidine;hydrochloride |
| SMILES | COc1cc(/C=C/CN2CCC(=C3c4ccccc4C=Cc4ccccc43)CC2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C32H33NO3.ClH/c1-34-29-21-23(22-30(35-2)32(29)36-3)9-8-18-33-19-16-26(17-20-33)31-27-12-6-4-10-24(27)14-15-25-11-5-7-13-28(25)31;/h4-15,21-22H,16-20H2,1-3H3;1H/b9-8+; |
| InChIKey | FSEXROTYMIRXEU-HRNDJLQDSA-N |
| XLogP | 7.23 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.08 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|