C32H32ClNO3 — CID 22990761
[3-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]prop-1-enyl]phenyl] 2-methoxyacetate;hydrochloride (PubChem CID 22990761) has the molecular formula C32H32ClNO3 and a molecular weight of 514.07 g/mol. Its IUPAC name is [3-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]prop-1-enyl]phenyl] 2-methoxyacetate;hydrochloride.
| Compound Name | [3-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]prop-1-enyl]phenyl] 2-methoxyacetate;hydrochloride |
|---|---|
| PubChem CID | 22990761 |
| Molecular Formula | C32H32ClNO3 |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | [3-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]prop-1-enyl]phenyl] 2-methoxyacetate;hydrochloride |
| SMILES | COCC(=O)Oc1cccc(/C=C/CN2CCC(=C3c4ccccc4C=Cc4ccccc43)CC2)c1.Cl |
| InChI | InChI=1S/C32H31NO3.ClH/c1-35-23-31(34)36-28-12-6-8-24(22-28)9-7-19-33-20-17-27(18-21-33)32-29-13-4-2-10-25(29)15-16-26-11-3-5-14-30(26)32;/h2-16,22H,17-21,23H2,1H3;1H/b9-7+; |
| InChIKey | URUBRRZYFYWBDQ-BXTVWIJMSA-N |
| XLogP | 6.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|