C26H30ClNO2 — CID 67914039
6-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]hexanoic acid;hydrochloride (PubChem CID 67914039) has the molecular formula C26H30ClNO2 and a molecular weight of 423.98 g/mol. Its IUPAC name is 6-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]hexanoic acid;hydrochloride.
| Compound Name | 6-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67914039 |
| Molecular Formula | C26H30ClNO2 |
| Molecular Weight | 423.98 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 6-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]hexanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCCN1CCC(=C2c3ccccc3C=Cc3ccccc32)CC1 |
| InChI | InChI=1S/C26H29NO2.ClH/c28-25(29)12-2-1-7-17-27-18-15-22(16-19-27)26-23-10-5-3-8-20(23)13-14-21-9-4-6-11-24(21)26;/h3-6,8-11,13-14H,1-2,7,12,15-19H2,(H,28,29);1H |
| InChIKey | QLLYZSZZLADXTP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.98 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|