C31H32ClNO2 — CID 139802281
1-(4-methoxyphenyl)-4-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]butan-1-one;hydrochloride (PubChem CID 139802281) has the molecular formula C31H32ClNO2 and a molecular weight of 486.06 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 1-(4-methoxyphenyl)-4-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 139802281 |
| Molecular Formula | C31H32ClNO2 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]butan-1-one;hydrochloride |
| SMILES | COc1ccc(C(=O)CCCN2CCC(=C3c4ccccc4C=Cc4ccccc43)CC2)cc1.Cl |
| InChI | InChI=1S/C31H31NO2.ClH/c1-34-27-16-14-25(15-17-27)30(33)11-6-20-32-21-18-26(19-22-32)31-28-9-4-2-7-23(28)12-13-24-8-3-5-10-29(24)31;/h2-5,7-10,12-17H,6,11,18-22H2,1H3;1H |
| InChIKey | LWNOKFQOTOEXOG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|