C32H35NO3 — CID 19749712
1-(3,4-dimethoxyphenyl)-4-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,12-hexaenylidene)piperidin-1-yl]butan-1-one (PubChem CID 19749712) has the molecular formula C32H35NO3 and a molecular weight of 481.64 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,12-hexaenylidene)piperidin-1-yl]butan-1-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,12-hexaenylidene)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 19749712 |
| Molecular Formula | C32H35NO3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,12-hexaenylidene)piperidin-1-yl]butan-1-one |
| SMILES | COc1ccc(C(=O)CCCN2CCC(=C3C4=C(C=CCC4)C=Cc4ccccc43)CC2)cc1OC |
| InChI | InChI=1S/C32H35NO3/c1-35-30-16-15-26(22-31(30)36-2)29(34)12-7-19-33-20-17-25(18-21-33)32-27-10-5-3-8-23(27)13-14-24-9-4-6-11-28(24)32/h3-5,8-10,13-16,22H,6-7,11-12,17-21H2,1-2H3 |
| InChIKey | AQJPVAQRTIXIOE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |