C17H25ClN2O3 — CID 173330854
4-(4-amino-3-chloropiperidin-1-yl)-1-(3,4-dimethoxyphenyl)butan-1-one (PubChem CID 173330854) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 4-(4-amino-3-chloropiperidin-1-yl)-1-(3,4-dimethoxyphenyl)butan-1-one.
| Compound Name | 4-(4-amino-3-chloropiperidin-1-yl)-1-(3,4-dimethoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 173330854 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-(4-amino-3-chloropiperidin-1-yl)-1-(3,4-dimethoxyphenyl)butan-1-one |
| SMILES | COc1ccc(C(=O)CCCN2CCC(N)C(Cl)C2)cc1OC |
| InChI | InChI=1S/C17H25ClN2O3/c1-22-16-6-5-12(10-17(16)23-2)15(21)4-3-8-20-9-7-14(19)13(18)11-20/h5-6,10,13-14H,3-4,7-9,11,19H2,1-2H3 |
| InChIKey | PJVRRGZHCVIPKR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|