C28H37ClN2O4 — CID 58456873
1-[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]oxy-3-methoxyphenyl]-5-morpholin-4-ylpentan-1-one (PubChem CID 58456873) has the molecular formula C28H37ClN2O4 and a molecular weight of 501.07 g/mol. Its IUPAC name is 1-[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]oxy-3-methoxyphenyl]-5-morpholin-4-ylpentan-1-one.
| Compound Name | 1-[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]oxy-3-methoxyphenyl]-5-morpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 58456873 |
| Molecular Formula | C28H37ClN2O4 |
| Molecular Weight | 501.07 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 1-[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]oxy-3-methoxyphenyl]-5-morpholin-4-ylpentan-1-one |
| SMILES | COc1cc(C(=O)CCCCN2CCOCC2)ccc1OC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C28H37ClN2O4/c1-33-28-20-23(26(32)4-2-3-13-30-16-18-34-19-17-30)7-10-27(28)35-25-11-14-31(15-12-25)21-22-5-8-24(29)9-6-22/h5-10,20,25H,2-4,11-19,21H2,1H3 |
| InChIKey | RRXUNJWWCHGDPF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.07 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|