C25H32N2O6 — CID 146931849
N-[4,5-dimethoxy-2-(5-morpholin-4-ylpentanoyl)phenyl]-4-methoxybenzamide (PubChem CID 146931849) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is N-[4,5-dimethoxy-2-(5-morpholin-4-ylpentanoyl)phenyl]-4-methoxybenzamide.
| Compound Name | N-[4,5-dimethoxy-2-(5-morpholin-4-ylpentanoyl)phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 146931849 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | N-[4,5-dimethoxy-2-(5-morpholin-4-ylpentanoyl)phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(OC)c(OC)cc2C(=O)CCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C25H32N2O6/c1-30-19-9-7-18(8-10-19)25(29)26-21-17-24(32-3)23(31-2)16-20(21)22(28)6-4-5-11-27-12-14-33-15-13-27/h7-10,16-17H,4-6,11-15H2,1-3H3,(H,26,29) |
| InChIKey | AFEHUOMSLVTYKE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|