C25H32N2O7 — CID 147839137
4-methoxy-N-[3,4,5-trimethoxy-2-(4-morpholin-4-ylbutanoyl)phenyl]benzamide (PubChem CID 147839137) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is 4-methoxy-N-[3,4,5-trimethoxy-2-(4-morpholin-4-ylbutanoyl)phenyl]benzamide.
| Compound Name | 4-methoxy-N-[3,4,5-trimethoxy-2-(4-morpholin-4-ylbutanoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 147839137 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-methoxy-N-[3,4,5-trimethoxy-2-(4-morpholin-4-ylbutanoyl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(OC)c(OC)c(OC)c2C(=O)CCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C25H32N2O7/c1-30-18-9-7-17(8-10-18)25(29)26-19-16-21(31-2)23(32-3)24(33-4)22(19)20(28)6-5-11-27-12-14-34-15-13-27/h7-10,16H,5-6,11-15H2,1-4H3,(H,26,29) |
| InChIKey | HSPVHUXDJFEEDL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |